C34H31FN2O6 — CID 25008835
[4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] 3-nitrobenzoate (PubChem CID 25008835) has the molecular formula C34H31FN2O6 and a molecular weight of 582.63 g/mol. Its IUPAC name is [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] 3-nitrobenzoate.
| Compound Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 25008835 |
| Molecular Formula | C34H31FN2O6 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] 3-nitrobenzoate |
| SMILES | COc1cc(OC(=O)c2cccc([N+](=O)[O-])c2)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C34H31FN2O6/c1-20-9-10-23(35)16-30(20)42-19-28-26(13-14-29-32(28)21(2)18-34(3,4)36-29)27-12-11-25(17-31(27)41-5)43-33(38)22-7-6-8-24(15-22)37(39)40/h6-18,36H,19H2,1-5H3 |
| InChIKey | WIPJTHVSMLYCFP-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|