C29H33N3O5 — CID 121274761
N-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenoxy]-N-methylmethanamine (PubChem CID 121274761) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenoxy]-N-methylmethanamine.
| Compound Name | N-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenoxy]-N-methylmethanamine |
|---|---|
| PubChem CID | 121274761 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenoxy]-N-methylmethanamine |
| SMILES | COc1cc(ON(C)C)ccc1-c1ccc2c(c1COc1cc([N+](=O)[O-])ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C29H33N3O5/c1-18-8-9-20(32(33)34)14-26(18)36-17-24-22(12-13-25-28(24)19(2)16-29(3,4)30-25)23-11-10-21(37-31(5)6)15-27(23)35-7/h8-16,30H,17H2,1-7H3 |
| InChIKey | ORKSVUQFOLWVOY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|