C27H27ClN2O4 — CID 16661279
6-(5-chloro-2-methoxyphenyl)-2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinoline (PubChem CID 16661279) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyphenyl)-2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinoline.
| Compound Name | 6-(5-chloro-2-methoxyphenyl)-2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinoline |
|---|---|
| PubChem CID | 16661279 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-(5-chloro-2-methoxyphenyl)-2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinoline |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1COc1cc([N+](=O)[O-])ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C27H27ClN2O4/c1-16-6-8-19(30(31)32)13-25(16)34-15-22-20(21-12-18(28)7-11-24(21)33-5)9-10-23-26(22)17(2)14-27(3,4)29-23/h6-14,29H,15H2,1-5H3 |
| InChIKey | YDQGLVGYJQGGLD-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|