C32H30N2O7 — CID 59224339
[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] furan-3-carboxylate (PubChem CID 59224339) has the molecular formula C32H30N2O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is [3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] furan-3-carboxylate.
| Compound Name | [3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 59224339 |
| Molecular Formula | C32H30N2O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | [3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] furan-3-carboxylate |
| SMILES | COc1cc(OC(=O)c2ccoc2)ccc1-c1ccc2c(c1COc1cc([N+](=O)[O-])ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C32H30N2O7/c1-19-6-7-22(34(36)37)14-28(19)40-18-26-24(10-11-27-30(26)20(2)16-32(3,4)33-27)25-9-8-23(15-29(25)38-5)41-31(35)21-12-13-39-17-21/h6-17,33H,18H2,1-5H3 |
| InChIKey | ONXSVVHHOOICEB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|