C33H34N2O7 — CID 143893625
[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] (2Z,4Z)-2-hydroxyhexa-2,4-dienoate (PubChem CID 143893625) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is [3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] (2Z,4Z)-2-hydroxyhexa-2,4-dienoate.
| Compound Name | [3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] (2Z,4Z)-2-hydroxyhexa-2,4-dienoate |
|---|---|
| PubChem CID | 143893625 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-1H-quinolin-6-yl]phenyl] (2Z,4Z)-2-hydroxyhexa-2,4-dienoate |
| SMILES | C/C=C\C=C(/O)C(=O)Oc1ccc(-c2ccc3c(c2COc2cc([N+](=O)[O-])ccc2C)C(C)=CC(C)(C)N3)c(OC)c1 |
| InChI | InChI=1S/C33H34N2O7/c1-7-8-9-28(36)32(37)42-23-12-13-25(30(17-23)40-6)24-14-15-27-31(21(3)18-33(4,5)34-27)26(24)19-41-29-16-22(35(38)39)11-10-20(29)2/h7-18,34,36H,19H2,1-6H3/b8-7-,28-9- |
| InChIKey | VHWALONYGXBTOX-BNIDWNKFSA-N |
| XLogP | 7.69 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|