C34H31ClN2O7 — CID 58505031
[3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-chlorobenzoate (PubChem CID 58505031) has the molecular formula C34H31ClN2O7 and a molecular weight of 615.08 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 58505031 |
| Molecular Formula | C34H31ClN2O7 |
| Molecular Weight | 615.08 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-chlorobenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCc1c(-c2ccc(OC(=O)c3ccc(Cl)cc3)cc2OC)ccc2c1C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C34H31ClN2O7/c1-20-18-34(2,3)36-28-14-13-25(27(32(20)28)19-43-31-16-23(37(39)40)10-15-29(31)41-4)26-12-11-24(17-30(26)42-5)44-33(38)21-6-8-22(35)9-7-21/h6-18,36H,19H2,1-5H3 |
| InChIKey | ACQZGNBUBWZMKG-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.08 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|