C36H35NO5 — CID 67373057
[6-(3-acetyloxy-2-methoxy-4-phenylphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methylbenzoate (PubChem CID 67373057) has the molecular formula C36H35NO5 and a molecular weight of 561.68 g/mol. Its IUPAC name is [6-(3-acetyloxy-2-methoxy-4-phenylphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methylbenzoate.
| Compound Name | [6-(3-acetyloxy-2-methoxy-4-phenylphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 67373057 |
| Molecular Formula | C36H35NO5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | [6-(3-acetyloxy-2-methoxy-4-phenylphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methylbenzoate |
| SMILES | COc1c(-c2ccc3c(c2COC(=O)c2ccc(C)cc2)C(C)=CC(C)(C)N3)ccc(-c2ccccc2)c1OC(C)=O |
| InChI | InChI=1S/C36H35NO5/c1-22-12-14-26(15-13-22)35(39)41-21-30-28(18-19-31-32(30)23(2)20-36(4,5)37-31)29-17-16-27(25-10-8-7-9-11-25)34(33(29)40-6)42-24(3)38/h7-20,37H,21H2,1-6H3 |
| InChIKey | QYJXDTSPORRBFE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|