C22H26N2O3 — CID 58026748
6-(2-hydroxyphenyl)-N-(2-methoxyethyl)-2,2,4-trimethyl-1H-quinoline-5-carboxamide (PubChem CID 58026748) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-N-(2-methoxyethyl)-2,2,4-trimethyl-1H-quinoline-5-carboxamide.
| Compound Name | 6-(2-hydroxyphenyl)-N-(2-methoxyethyl)-2,2,4-trimethyl-1H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 58026748 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 6-(2-hydroxyphenyl)-N-(2-methoxyethyl)-2,2,4-trimethyl-1H-quinoline-5-carboxamide |
| SMILES | COCCNC(=O)c1c(-c2ccccc2O)ccc2c1C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C22H26N2O3/c1-14-13-22(2,3)24-17-10-9-16(15-7-5-6-8-18(15)25)20(19(14)17)21(26)23-11-12-27-4/h5-10,13,24-25H,11-12H2,1-4H3,(H,23,26) |
| InChIKey | BCRYANCKCDDNEQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|