C29H32N2O5S — CID 24882823
[3-methoxy-4-[4-[(2-methoxyanilino)methyl]-2,2-dimethyl-1H-quinolin-6-yl]phenyl] cyclopropanesulfonate (PubChem CID 24882823) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is [3-methoxy-4-[4-[(2-methoxyanilino)methyl]-2,2-dimethyl-1H-quinolin-6-yl]phenyl] cyclopropanesulfonate.
| Compound Name | [3-methoxy-4-[4-[(2-methoxyanilino)methyl]-2,2-dimethyl-1H-quinolin-6-yl]phenyl] cyclopropanesulfonate |
|---|---|
| PubChem CID | 24882823 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [3-methoxy-4-[4-[(2-methoxyanilino)methyl]-2,2-dimethyl-1H-quinolin-6-yl]phenyl] cyclopropanesulfonate |
| SMILES | COc1ccccc1NCC1=CC(C)(C)Nc2ccc(-c3ccc(OS(=O)(=O)C4CC4)cc3OC)cc21 |
| InChI | InChI=1S/C29H32N2O5S/c1-29(2)17-20(18-30-26-7-5-6-8-27(26)34-3)24-15-19(9-14-25(24)31-29)23-13-10-21(16-28(23)35-4)36-37(32,33)22-11-12-22/h5-10,13-17,22,30-31H,11-12,18H2,1-4H3 |
| InChIKey | WEZORTWDBBQJAU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|