C31H34N2O5S — CID 88944445
[3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopentanesulfonate (PubChem CID 88944445) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopentanesulfonate.
| Compound Name | [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopentanesulfonate |
|---|---|
| PubChem CID | 88944445 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopentanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C2CCCC2)ccc1-c1ccc2c3c1CN(c1ccccc1OC)C3=CC(C)(C)N2 |
| InChI | InChI=1S/C31H34N2O5S/c1-31(2)18-27-30-24(19-33(27)26-11-7-8-12-28(26)36-3)22(15-16-25(30)32-31)23-14-13-20(17-29(23)37-4)38-39(34,35)21-9-5-6-10-21/h7-8,11-18,21,32H,5-6,9-10,19H2,1-4H3 |
| InChIKey | DRNWUWFAYSMIJE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|