C33H29N3O6 — CID 70658630
[3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] 2-nitrobenzoate (PubChem CID 70658630) has the molecular formula C33H29N3O6 and a molecular weight of 563.61 g/mol. Its IUPAC name is [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] 2-nitrobenzoate.
| Compound Name | [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 70658630 |
| Molecular Formula | C33H29N3O6 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] 2-nitrobenzoate |
| SMILES | COc1cc(OC(=O)c2ccccc2[N+](=O)[O-])ccc1-c1ccc2c3c1CN(c1ccccc1OC)C3=CC(C)(C)N2 |
| InChI | InChI=1S/C33H29N3O6/c1-33(2)18-28-31-24(19-35(28)27-11-7-8-12-29(27)40-3)21(15-16-25(31)34-33)22-14-13-20(17-30(22)41-4)42-32(37)23-9-5-6-10-26(23)36(38)39/h5-18,34H,19H2,1-4H3 |
| InChIKey | AQPFEHOSHCCWTH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|