C29H30N2O4S — CID 121274750
[3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopropanesulfinate (PubChem CID 121274750) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopropanesulfinate.
| Compound Name | [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopropanesulfinate |
|---|---|
| PubChem CID | 121274750 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [3-methoxy-4-[2-(2-methoxyphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]phenyl] cyclopropanesulfinate |
| SMILES | COc1cc(OS(=O)C2CC2)ccc1-c1ccc2c3c1CN(c1ccccc1OC)C3=CC(C)(C)N2 |
| InChI | InChI=1S/C29H30N2O4S/c1-29(2)16-25-28-22(17-31(25)24-7-5-6-8-26(24)33-3)20(13-14-23(28)30-29)21-12-9-18(15-27(21)34-4)35-36(32)19-10-11-19/h5-9,12-16,19,30H,10-11,17H2,1-4H3 |
| InChIKey | VJLKGUJGLWTGSH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |