C26H27N3O4 — CID 143956222
5-(4-hydroxy-2-methoxyphenyl)-2-(2-methoxyphenyl)-10,10-dimethyl-1,2,9-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-12-one (PubChem CID 143956222) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 5-(4-hydroxy-2-methoxyphenyl)-2-(2-methoxyphenyl)-10,10-dimethyl-1,2,9-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-12-one.
| Compound Name | 5-(4-hydroxy-2-methoxyphenyl)-2-(2-methoxyphenyl)-10,10-dimethyl-1,2,9-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-12-one |
|---|---|
| PubChem CID | 143956222 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 5-(4-hydroxy-2-methoxyphenyl)-2-(2-methoxyphenyl)-10,10-dimethyl-1,2,9-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-12-one |
| SMILES | COc1cc(O)ccc1-c1ccc2c3c1CN(c1ccccc1OC)N3C(=O)CC(C)(C)N2 |
| InChI | InChI=1S/C26H27N3O4/c1-26(2)14-24(31)29-25-19(15-28(29)21-7-5-6-8-22(21)32-3)17(11-12-20(25)27-26)18-10-9-16(30)13-23(18)33-4/h5-13,27,30H,14-15H2,1-4H3 |
| InChIKey | HBFRZSOMDJWFDQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |