C15H22N2O2 — CID 117023902
4-(2-methoxyphenyl)-3,3,6,6-tetramethylpiperazin-2-one (PubChem CID 117023902) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-3,3,6,6-tetramethylpiperazin-2-one.
| Compound Name | 4-(2-methoxyphenyl)-3,3,6,6-tetramethylpiperazin-2-one |
|---|---|
| PubChem CID | 117023902 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-(2-methoxyphenyl)-3,3,6,6-tetramethylpiperazin-2-one |
| SMILES | COc1ccccc1N1CC(C)(C)NC(=O)C1(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-14(2)10-17(15(3,4)13(18)16-14)11-8-6-7-9-12(11)19-5/h6-9H,10H2,1-5H3,(H,16,18) |
| InChIKey | SQCFQCSABILRLW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |