C14H20N2O2 — CID 117023693
4-(2-methoxyphenyl)-2,2-dimethyl-1,4-diazepan-5-one (PubChem CID 117023693) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2,2-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(2-methoxyphenyl)-2,2-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023693 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-(2-methoxyphenyl)-2,2-dimethyl-1,4-diazepan-5-one |
| SMILES | COc1ccccc1N1CC(C)(C)NCCC1=O |
| InChI | InChI=1S/C14H20N2O2/c1-14(2)10-16(13(17)8-9-15-14)11-6-4-5-7-12(11)18-3/h4-7,15H,8-10H2,1-3H3 |
| InChIKey | GNFIVLIINKYRIM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |