carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one

C14H15NO4 — CID 158537394

IUPACcarbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one
SMILESC=C1CCN(c2ccccc2OC)C(=O)C1.O=C=O
InChIInChI=1S/C13H15NO2.CO2/c1-10-7-8-14(13(15)9-10)11-5-3-4-6-12(11)16-2;2-1-3/h3-6H,1,7-9H2,2H3;
InChIKeyHOCKSHMORHOKAF-UHFFFAOYSA-N
MW261.28 g/mol
LogP1.79
Rot. Bonds2

About carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one

carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one (PubChem CID 158537394) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one.

Molecular Properties

Compound Namecarbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one
PubChem CID158537394
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Namecarbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one
SMILESC=C1CCN(c2ccccc2OC)C(=O)C1.O=C=O
InChIInChI=1S/C13H15NO2.CO2/c1-10-7-8-14(13(15)9-10)11-5-3-4-6-12(11)16-2;2-1-3/h3-6H,1,7-9H2,2H3;
InChIKeyHOCKSHMORHOKAF-UHFFFAOYSA-N
XLogP1.79
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 51.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one?
The IUPAC name of carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one (CID 158537394) is carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one.
What is the SMILES notation for carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one?
The canonical SMILES for carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one is C=C1CCN(c2ccccc2OC)C(=O)C1.O=C=O.
What is the InChIKey of carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one?
The InChIKey is HOCKSHMORHOKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2.CO2/c1-10-7-8-14(13(15)9-10)11-5-3-4-6-12(11)16-2;2-1-3/h3-6H,1,7-9H2,2H3;.
What are the key properties of carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one?
carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one has a molecular weight of 261.28 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-(2-methoxyphenyl)-4-methylidenepiperidin-2-one is sourced from PubChem (CID 158537394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).