C14H14N2O3 — CID 146074791
1-(2-methoxyphenyl)-4-prop-2-ynylpiperazine-2,3-dione (PubChem CID 146074791) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-prop-2-ynylpiperazine-2,3-dione.
| Compound Name | 1-(2-methoxyphenyl)-4-prop-2-ynylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 146074791 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-prop-2-ynylpiperazine-2,3-dione |
| SMILES | C#CCN1CCN(c2ccccc2OC)C(=O)C1=O |
| InChI | InChI=1S/C14H14N2O3/c1-3-8-15-9-10-16(14(18)13(15)17)11-6-4-5-7-12(11)19-2/h1,4-7H,8-10H2,2H3 |
| InChIKey | JRICOTBIFVJSTM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|