C15H22N2O — CID 117023670
4-(2,4-dimethylphenyl)-2,2-dimethyl-1,4-diazepan-5-one (PubChem CID 117023670) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2,2-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(2,4-dimethylphenyl)-2,2-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023670 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2,2-dimethyl-1,4-diazepan-5-one |
| SMILES | Cc1ccc(N2CC(C)(C)NCCC2=O)c(C)c1 |
| InChI | InChI=1S/C15H22N2O/c1-11-5-6-13(12(2)9-11)17-10-15(3,4)16-8-7-14(17)18/h5-6,9,16H,7-8,10H2,1-4H3 |
| InChIKey | WPWRXYVSNGFQOK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |