C34H34FN3O5 — CID 143777253
[4-[2-[(2Z,4E,6Z)-5-fluoroocta-2,4,6-trien-3-yl]-10,10-dimethyl-11-oxo-1,2,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-5-yl]-3-methoxyphenyl] 4-methoxybenzoate (PubChem CID 143777253) has the molecular formula C34H34FN3O5 and a molecular weight of 583.66 g/mol. Its IUPAC name is [4-[2-[(2Z,4E,6Z)-5-fluoroocta-2,4,6-trien-3-yl]-10,10-dimethyl-11-oxo-1,2,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-5-yl]-3-methoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[2-[(2Z,4E,6Z)-5-fluoroocta-2,4,6-trien-3-yl]-10,10-dimethyl-11-oxo-1,2,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-5-yl]-3-methoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 143777253 |
| Molecular Formula | C34H34FN3O5 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | [4-[2-[(2Z,4E,6Z)-5-fluoroocta-2,4,6-trien-3-yl]-10,10-dimethyl-11-oxo-1,2,9-triazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-5-yl]-3-methoxyphenyl] 4-methoxybenzoate |
| SMILES | C/C=C\C(F)=C/C(=C/C)N1Cc2c(-c3ccc(OC(=O)c4ccc(OC)cc4)cc3OC)ccc3c2N1C(=O)C(C)(C)N3 |
| InChI | InChI=1S/C34H34FN3O5/c1-7-9-22(35)18-23(8-2)37-20-28-26(16-17-29-31(28)38(37)33(40)34(3,4)36-29)27-15-14-25(19-30(27)42-6)43-32(39)21-10-12-24(41-5)13-11-21/h7-19,36H,20H2,1-6H3/b9-7-,22-18+,23-8- |
| InChIKey | JORMQMWOCCKAAS-PAQWFKQASA-N |
| XLogP | 7.19 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|