C32H30N4O8 — CID 25227051
[3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] pyridine-3-carboxylate (PubChem CID 25227051) has the molecular formula C32H30N4O8 and a molecular weight of 598.61 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] pyridine-3-carboxylate.
| Compound Name | [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 25227051 |
| Molecular Formula | C32H30N4O8 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] pyridine-3-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCc1c(-c2ccc(OC(=O)c3cccnc3)cc2OC)ccc2c1N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C32H30N4O8/c1-32(2)31(38)35(3)29-24(18-43-28-15-20(36(39)40)8-13-26(28)41-4)22(11-12-25(29)34-32)23-10-9-21(16-27(23)42-5)44-30(37)19-7-6-14-33-17-19/h6-17,34H,18H2,1-5H3 |
| InChIKey | KFPHFPSZOZAKHA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|