C33H34N4O5 — CID 158686997
[3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-pyridin-3-ylacetate (PubChem CID 158686997) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-pyridin-3-ylacetate.
| Compound Name | [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-pyridin-3-ylacetate |
|---|---|
| PubChem CID | 158686997 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-pyridin-3-ylacetate |
| SMILES | COc1ccccc1NCc1c(-c2ccc(OC(=O)Cc3cccnc3)cc2OC)ccc2c1N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C33H34N4O5/c1-33(2)32(39)37(3)31-25(20-35-26-10-6-7-11-28(26)40-4)23(14-15-27(31)36-33)24-13-12-22(18-29(24)41-5)42-30(38)17-21-9-8-16-34-19-21/h6-16,18-19,35-36H,17,20H2,1-5H3 |
| InChIKey | IFWGAAOLLUSNCU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|