C29H32N2O6 — CID 58337201
[6-[2-methoxy-4-(methoxymethoxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]methyl 4-methylbenzoate (PubChem CID 58337201) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is [6-[2-methoxy-4-(methoxymethoxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]methyl 4-methylbenzoate.
| Compound Name | [6-[2-methoxy-4-(methoxymethoxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 58337201 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [6-[2-methoxy-4-(methoxymethoxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]methyl 4-methylbenzoate |
| SMILES | COCOc1ccc(-c2ccc3c(c2COC(=O)c2ccc(C)cc2)N(C)C(=O)C(C)(C)N3)c(OC)c1 |
| InChI | InChI=1S/C29H32N2O6/c1-18-7-9-19(10-8-18)27(32)36-16-23-21(22-12-11-20(37-17-34-5)15-25(22)35-6)13-14-24-26(23)31(4)28(33)29(2,3)30-24/h7-15,30H,16-17H2,1-6H3 |
| InChIKey | GVNRQNFFJXNZEE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|