C24H27FN2O3 — CID 143539590
7-(5-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]-4H-quinoxalin-2-one (PubChem CID 143539590) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 7-(5-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]-4H-quinoxalin-2-one.
| Compound Name | 7-(5-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]-4H-quinoxalin-2-one |
|---|---|
| PubChem CID | 143539590 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 7-(5-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]-4H-quinoxalin-2-one |
| SMILES | C=C/C(=C\C)OCc1c(-c2cc(F)ccc2OC)ccc2c1N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C24H27FN2O3/c1-7-16(8-2)30-14-19-17(18-13-15(25)9-12-21(18)29-6)10-11-20-22(19)27(5)23(28)24(3,4)26-20/h7-13,26H,1,14H2,2-6H3/b16-8+ |
| InChIKey | UHJSXYNHXUBCSV-LZYBPNLTSA-N |
| XLogP | 5.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|