C30H32N2O9 — CID 67177059
[4-[3,6-dihydroxy-2-[(2-methoxy-5-nitrophenoxy)methyl]-3,5,5-trimethylcyclohexen-1-yl]-3-methoxyphenyl] pyridine-3-carboxylate (PubChem CID 67177059) has the molecular formula C30H32N2O9 and a molecular weight of 564.59 g/mol. Its IUPAC name is [4-[3,6-dihydroxy-2-[(2-methoxy-5-nitrophenoxy)methyl]-3,5,5-trimethylcyclohexen-1-yl]-3-methoxyphenyl] pyridine-3-carboxylate.
| Compound Name | [4-[3,6-dihydroxy-2-[(2-methoxy-5-nitrophenoxy)methyl]-3,5,5-trimethylcyclohexen-1-yl]-3-methoxyphenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67177059 |
| Molecular Formula | C30H32N2O9 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [4-[3,6-dihydroxy-2-[(2-methoxy-5-nitrophenoxy)methyl]-3,5,5-trimethylcyclohexen-1-yl]-3-methoxyphenyl] pyridine-3-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCC1=C(c2ccc(OC(=O)c3cccnc3)cc2OC)C(O)C(C)(C)CC1(C)O |
| InChI | InChI=1S/C30H32N2O9/c1-29(2)17-30(3,35)22(16-40-25-13-19(32(36)37)8-11-23(25)38-4)26(27(29)33)21-10-9-20(14-24(21)39-5)41-28(34)18-7-6-12-31-15-18/h6-15,27,33,35H,16-17H2,1-5H3 |
| InChIKey | OKFCUUJJTALJBZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|