C30H28N4O8S — CID 25227052
[3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 1,3-thiazole-4-carboxylate (PubChem CID 25227052) has the molecular formula C30H28N4O8S and a molecular weight of 604.64 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 1,3-thiazole-4-carboxylate.
| Compound Name | [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 25227052 |
| Molecular Formula | C30H28N4O8S |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | [3-methoxy-4-[5-[(2-methoxy-5-nitrophenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]phenyl] 1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCc1c(-c2ccc(OC(=O)c3cscn3)cc2OC)ccc2c1N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C30H28N4O8S/c1-30(2)29(36)33(3)27-21(14-41-26-12-17(34(37)38)6-11-24(26)39-4)19(9-10-22(27)32-30)20-8-7-18(13-25(20)40-5)42-28(35)23-15-43-16-31-23/h6-13,15-16,32H,14H2,1-5H3 |
| InChIKey | LOWXVKPGHVPJBQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|