C34H33N3O6S — CID 25224814
O-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-methylbenzenecarbothioate (PubChem CID 25224814) has the molecular formula C34H33N3O6S and a molecular weight of 611.72 g/mol. Its IUPAC name is O-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-methylbenzenecarbothioate.
| Compound Name | O-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 25224814 |
| Molecular Formula | C34H33N3O6S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | O-[3-methoxy-4-[2,2,4-trimethyl-5-[(2-methyl-5-nitrophenoxy)methyl]-3-oxo-1H-quinoxalin-6-yl]phenyl] 2-methylbenzenecarbothioate |
| SMILES | COc1cc(OC(=S)c2ccccc2C)ccc1-c1ccc2c(c1COc1cc([N+](=O)[O-])ccc1C)N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C34H33N3O6S/c1-20-9-7-8-10-24(20)32(44)43-23-13-14-26(30(18-23)41-6)25-15-16-28-31(36(5)33(38)34(3,4)35-28)27(25)19-42-29-17-22(37(39)40)12-11-21(29)2/h7-18,35H,19H2,1-6H3 |
| InChIKey | NYTMUBFYBSQFOS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|