C27H27FN2O4S — CID 88877924
[4-[2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]-3-methoxyphenyl] methanesulfonate (PubChem CID 88877924) has the molecular formula C27H27FN2O4S and a molecular weight of 494.59 g/mol. Its IUPAC name is [4-[2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]-3-methoxyphenyl] methanesulfonate.
| Compound Name | [4-[2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]-3-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 88877924 |
| Molecular Formula | C27H27FN2O4S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | [4-[2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-5-yl]-3-methoxyphenyl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)ccc1-c1ccc2c3c1CN(c1cc(F)ccc1C)C3=CC(C)(C)N2 |
| InChI | InChI=1S/C27H27FN2O4S/c1-16-6-7-17(28)12-23(16)30-15-21-19(10-11-22-26(21)24(30)14-27(2,3)29-22)20-9-8-18(13-25(20)33-4)34-35(5,31)32/h6-14,29H,15H2,1-5H3 |
| InChIKey | RLJGQKQCHDPSBK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|