C30H34N2O7S2 — CID 25118470
[[6-(4-cyclopentylsulfonyloxy-2-methoxyphenyl)-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate (PubChem CID 25118470) has the molecular formula C30H34N2O7S2 and a molecular weight of 598.74 g/mol. Its IUPAC name is [[6-(4-cyclopentylsulfonyloxy-2-methoxyphenyl)-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate.
| Compound Name | [[6-(4-cyclopentylsulfonyloxy-2-methoxyphenyl)-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate |
|---|---|
| PubChem CID | 25118470 |
| Molecular Formula | C30H34N2O7S2 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | [[6-(4-cyclopentylsulfonyloxy-2-methoxyphenyl)-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate |
| SMILES | COc1cc(OS(=O)(=O)C2CCCC2)ccc1-c1ccc2c(c1C(OC=O)c1ccc(C)s1)N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C30H34N2O7S2/c1-18-10-15-25(40-18)28(38-17-33)26-22(13-14-23-27(26)32(4)29(34)30(2,3)31-23)21-12-11-19(16-24(21)37-5)39-41(35,36)20-8-6-7-9-20/h10-17,20,28,31H,6-9H2,1-5H3 |
| InChIKey | RGACHZSTAMTSMU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|