C29H34N2O7S2 — CID 25118120
[[6-[2-methoxy-4-(2-methylpropylsulfonyloxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate (PubChem CID 25118120) has the molecular formula C29H34N2O7S2 and a molecular weight of 586.73 g/mol. Its IUPAC name is [[6-[2-methoxy-4-(2-methylpropylsulfonyloxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate.
| Compound Name | [[6-[2-methoxy-4-(2-methylpropylsulfonyloxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate |
|---|---|
| PubChem CID | 25118120 |
| Molecular Formula | C29H34N2O7S2 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [[6-[2-methoxy-4-(2-methylpropylsulfonyloxy)phenyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-5-yl]-(5-methylthiophen-2-yl)methyl] formate |
| SMILES | COc1cc(OS(=O)(=O)CC(C)C)ccc1-c1ccc2c(c1C(OC=O)c1ccc(C)s1)N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C29H34N2O7S2/c1-17(2)15-40(34,35)38-19-9-10-20(23(14-19)36-7)21-11-12-22-26(31(6)28(33)29(4,5)30-22)25(21)27(37-16-32)24-13-8-18(3)39-24/h8-14,16-17,27,30H,15H2,1-7H3 |
| InChIKey | YPJRAYOZQLCQTF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|