C28H31NO2S — CID 10343495
6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline (PubChem CID 10343495) has the molecular formula C28H31NO2S and a molecular weight of 445.63 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline.
| Compound Name | 6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
|---|---|
| PubChem CID | 10343495 |
| Molecular Formula | C28H31NO2S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
| SMILES | COc1ccc(OC)c(-c2ccc3c(c2)C(CSCCc2ccccc2)=CC(C)(C)N3)c1 |
| InChI | InChI=1S/C28H31NO2S/c1-28(2)18-22(19-32-15-14-20-8-6-5-7-9-20)24-16-21(10-12-26(24)29-28)25-17-23(30-3)11-13-27(25)31-4/h5-13,16-18,29H,14-15,19H2,1-4H3 |
| InChIKey | FGBRDKXWKNRXPK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|