C26H28FNS — CID 142866238
6-(2-fluorocyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline (PubChem CID 142866238) has the molecular formula C26H28FNS and a molecular weight of 405.58 g/mol. Its IUPAC name is 6-(2-fluorocyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline.
| Compound Name | 6-(2-fluorocyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
|---|---|
| PubChem CID | 142866238 |
| Molecular Formula | C26H28FNS |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 6-(2-fluorocyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
| SMILES | CC1(C)C=C(CSCCc2ccccc2)c2cc(C3=C(F)CCC=C3)ccc2N1 |
| InChI | InChI=1S/C26H28FNS/c1-26(2)17-21(18-29-15-14-19-8-4-3-5-9-19)23-16-20(12-13-25(23)28-26)22-10-6-7-11-24(22)27/h3-6,8-10,12-13,16-17,28H,7,11,14-15,18H2,1-2H3 |
| InChIKey | MMLBTZSIULNWOB-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|