C38H45F3N2O4S2 — CID 86592913
6-(2-methoxy-5-propan-2-ylphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate (PubChem CID 86592913) has the molecular formula C38H45F3N2O4S2 and a molecular weight of 714.92 g/mol. Its IUPAC name is 6-(2-methoxy-5-propan-2-ylphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate.
| Compound Name | 6-(2-methoxy-5-propan-2-ylphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86592913 |
| Molecular Formula | C38H45F3N2O4S2 |
| Molecular Weight | 714.92 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | 6-(2-methoxy-5-propan-2-ylphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate |
| SMILES | C=CCSCC1=CC(C)(C)Nc2ccc(-c3cc(C(C)C)ccc3OC)cc21.CC1=CC(C)(C)Nc2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C25H31NOS.C13H14F3NO3S/c1-7-12-28-16-20-15-25(4,5)26-23-10-8-19(14-21(20)23)22-13-18(17(2)3)9-11-24(22)27-6;1-8-7-12(2,3)17-11-5-4-9(6-10(8)11)20-21(18,19)13(14,15)16/h7-11,13-15,17,26H,1,12,16H2,2-6H3;4-7,17H,1-3H3 |
| InChIKey | BEEOJKJQSSMKAD-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.92 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|