C27H24F3NO5S — CID 22314923
[3-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)phenyl] trifluoromethanesulfonate (PubChem CID 22314923) has the molecular formula C27H24F3NO5S and a molecular weight of 531.55 g/mol. Its IUPAC name is [3-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22314923 |
| Molecular Formula | C27H24F3NO5S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | [3-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1cccc2c1-c1ccc3c(c1C(c1cccc(OS(=O)(=O)C(F)(F)F)c1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C27H24F3NO5S/c1-15-14-26(2,3)31-19-12-11-18-23-20(34-4)9-6-10-21(23)35-25(24(18)22(15)19)16-7-5-8-17(13-16)36-37(32,33)27(28,29)30/h5-14,25,31H,1-4H3 |
| InChIKey | KXQGQGARGXLWNA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|