C24H28N2O4 — CID 23552307
N-methoxy-2-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)-N-methylacetamide (PubChem CID 23552307) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-methoxy-2-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)-N-methylacetamide.
| Compound Name | N-methoxy-2-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 23552307 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-methoxy-2-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)-N-methylacetamide |
| SMILES | COc1cccc2c1-c1ccc3c(c1C(CC(=O)N(C)OC)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C24H28N2O4/c1-14-13-24(2,3)25-16-11-10-15-22-17(28-5)8-7-9-18(22)30-19(23(15)21(14)16)12-20(27)26(4)29-6/h7-11,13,19,25H,12H2,1-6H3 |
| InChIKey | DAUHHCGZVQPPRX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|