C28H33NO2 — CID 74972411
5-cyclooct-2-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 74972411) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 5-cyclooct-2-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 5-cyclooct-2-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 74972411 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 5-cyclooct-2-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | COc1cccc2c1-c1ccc3c(c1C(C1C=CCCCCC1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C28H33NO2/c1-18-17-28(2,3)29-21-16-15-20-25-22(30-4)13-10-14-23(25)31-27(26(20)24(18)21)19-11-8-6-5-7-9-12-19/h8,10-11,13-17,19,27,29H,5-7,9,12H2,1-4H3 |
| InChIKey | NYZPSKBMSBIASN-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|