C25H27NO3 — CID 22314860
5-cyclopent-3-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol (PubChem CID 22314860) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-cyclopent-3-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol.
| Compound Name | 5-cyclopent-3-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 22314860 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 5-cyclopent-3-en-1-yl-10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1C(C1CC=CC1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C25H27NO3/c1-14-13-25(2,3)26-17-10-9-16-21-19(12-11-18(27)24(21)28-4)29-23(22(16)20(14)17)15-7-5-6-8-15/h5-6,9-13,15,23,26-27H,7-8H2,1-4H3 |
| InChIKey | ZJDOKOYFQMUCAA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|