C28H25NO5 — CID 11213215
(5Z)-5-(1,3-benzodioxol-4-ylmethylidene)-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 11213215) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-4-ylmethylidene)-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5Z)-5-(1,3-benzodioxol-4-ylmethylidene)-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 11213215 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-4-ylmethylidene)-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1/C(=C/c1cccc4c1OCO4)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C28H25NO5/c1-15-13-28(2,3)29-18-9-8-17-24(23(15)18)22(12-16-6-5-7-21-26(16)33-14-32-21)34-20-11-10-19(30)27(31-4)25(17)20/h5-13,29-30H,14H2,1-4H3/b22-12- |
| InChIKey | WKAMUFODIXDKBL-UUYOSTAYSA-N |
| XLogP | 6.29 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|