C35H41NO3 — CID 11295406
(5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 11295406) has the molecular formula C35H41NO3 and a molecular weight of 523.72 g/mol. Its IUPAC name is (5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 11295406 |
| Molecular Formula | C35H41NO3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | (5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1/C(=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C35H41NO3/c1-20-19-35(8,9)36-25-12-11-24-30(29(20)25)28(39-27-14-13-26(37)32(38-10)31(24)27)17-21-15-22(33(2,3)4)18-23(16-21)34(5,6)7/h11-19,36-37H,1-10H3/b28-17- |
| InChIKey | BGLLEMWYIFVVKK-QRQIAZFYSA-N |
| XLogP | 9.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|