C28H26N2O4 — CID 91520703
10-methoxy-2,2,4-trimethyl-5-[[2-(nitrosomethyl)phenyl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 91520703) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 10-methoxy-2,2,4-trimethyl-5-[[2-(nitrosomethyl)phenyl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | 10-methoxy-2,2,4-trimethyl-5-[[2-(nitrosomethyl)phenyl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 91520703 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 10-methoxy-2,2,4-trimethyl-5-[[2-(nitrosomethyl)phenyl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1C(=Cc1ccccc1CN=O)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C28H26N2O4/c1-16-14-28(2,3)30-20-10-9-19-25(24(16)20)23(13-17-7-5-6-8-18(17)15-29-32)34-22-12-11-21(31)27(33-4)26(19)22/h5-14,30-31H,15H2,1-4H3 |
| InChIKey | BHYAEHUDODPUQH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|