C33H30N2O4S — CID 11478401
(5Z)-10-methoxy-2,2,4-trimethyl-5-[[3-[(E)-C-methyl-N-phenoxycarbonimidoyl]thiophen-2-yl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 11478401) has the molecular formula C33H30N2O4S and a molecular weight of 550.68 g/mol. Its IUPAC name is (5Z)-10-methoxy-2,2,4-trimethyl-5-[[3-[(E)-C-methyl-N-phenoxycarbonimidoyl]thiophen-2-yl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5Z)-10-methoxy-2,2,4-trimethyl-5-[[3-[(E)-C-methyl-N-phenoxycarbonimidoyl]thiophen-2-yl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 11478401 |
| Molecular Formula | C33H30N2O4S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | (5Z)-10-methoxy-2,2,4-trimethyl-5-[[3-[(E)-C-methyl-N-phenoxycarbonimidoyl]thiophen-2-yl]methylidene]-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1/C(=C/c1sccc1/C(C)=N/Oc1ccccc1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C33H30N2O4S/c1-19-18-33(3,4)34-24-12-11-23-30(29(19)24)27(38-26-14-13-25(36)32(37-5)31(23)26)17-28-22(15-16-40-28)20(2)35-39-21-9-7-6-8-10-21/h6-18,34,36H,1-5H3/b27-17-,35-20+ |
| InChIKey | WSCGWVXMROCILW-LNULUVBFSA-N |
| XLogP | 8.43 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|