C31H27NO3S — CID 72753654
10-methoxy-2,2,4-trimethyl-5-[(3-thiophen-3-ylphenyl)methylidene]-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 72753654) has the molecular formula C31H27NO3S and a molecular weight of 493.63 g/mol. Its IUPAC name is 10-methoxy-2,2,4-trimethyl-5-[(3-thiophen-3-ylphenyl)methylidene]-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | 10-methoxy-2,2,4-trimethyl-5-[(3-thiophen-3-ylphenyl)methylidene]-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 72753654 |
| Molecular Formula | C31H27NO3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 10-methoxy-2,2,4-trimethyl-5-[(3-thiophen-3-ylphenyl)methylidene]-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1C(=Cc1cccc(-c4ccsc4)c1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C31H27NO3S/c1-18-16-31(2,3)32-23-9-8-22-28(27(18)23)26(35-25-11-10-24(33)30(34-4)29(22)25)15-19-6-5-7-20(14-19)21-12-13-36-17-21/h5-17,32-33H,1-4H3 |
| InChIKey | KPICRRQXJIKREI-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|