C25H29NO2 — CID 10193923
10-methoxy-2,2,4-trimethyl-5-(3-methylbut-3-enyl)-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 10193923) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 10-methoxy-2,2,4-trimethyl-5-(3-methylbut-3-enyl)-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 10-methoxy-2,2,4-trimethyl-5-(3-methylbut-3-enyl)-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10193923 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 10-methoxy-2,2,4-trimethyl-5-(3-methylbut-3-enyl)-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | C=C(C)CCC1Oc2cccc(OC)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C25H29NO2/c1-15(2)10-13-21-24-17(23-19(27-6)8-7-9-20(23)28-21)11-12-18-22(24)16(3)14-25(4,5)26-18/h7-9,11-12,14,21,26H,1,10,13H2,2-6H3 |
| InChIKey | HIOYBADMRCXXFB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|