C22H22ClNO — CID 11089468
10-chloro-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 11089468) has the molecular formula C22H22ClNO and a molecular weight of 351.88 g/mol. Its IUPAC name is 10-chloro-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 10-chloro-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 11089468 |
| Molecular Formula | C22H22ClNO |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 10-chloro-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | C=CCC1Oc2cccc(Cl)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C22H22ClNO/c1-5-7-17-21-14(20-15(23)8-6-9-18(20)25-17)10-11-16-19(21)13(2)12-22(3,4)24-16/h5-6,8-12,17,24H,1,7H2,2-4H3 |
| InChIKey | UXGUYYJUKZKENF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|