C32H34N2O4 — CID 23552302
[(E)-4-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)but-2-enyl] N-benzylcarbamate (PubChem CID 23552302) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is [(E)-4-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)but-2-enyl] N-benzylcarbamate.
| Compound Name | [(E)-4-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)but-2-enyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 23552302 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | [(E)-4-(10-methoxy-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-yl)but-2-enyl] N-benzylcarbamate |
| SMILES | COc1cccc2c1-c1ccc3c(c1C(C/C=C/COC(=O)NCc1ccccc1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C32H34N2O4/c1-21-19-32(2,3)34-24-17-16-23-29-25(36-4)14-10-15-26(29)38-27(30(23)28(21)24)13-8-9-18-37-31(35)33-20-22-11-6-5-7-12-22/h5-12,14-17,19,27,34H,13,18,20H2,1-4H3,(H,33,35)/b9-8+ |
| InChIKey | IWBITJFVVUVFGL-CMDGGOBGSA-N |
| XLogP | 7.28 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|