C22H25NOS — CID 69153225
8-(2-methoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline (PubChem CID 69153225) has the molecular formula C22H25NOS and a molecular weight of 351.52 g/mol. Its IUPAC name is 8-(2-methoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline.
| Compound Name | 8-(2-methoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline |
|---|---|
| PubChem CID | 69153225 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 8-(2-methoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline |
| SMILES | C=CCSCC1=CC(C)(C)Nc2c1cccc2-c1ccccc1OC |
| InChI | InChI=1S/C22H25NOS/c1-5-13-25-15-16-14-22(2,3)23-21-17(16)10-8-11-19(21)18-9-6-7-12-20(18)24-4/h5-12,14,23H,1,13,15H2,2-4H3 |
| InChIKey | XURAQCFRBNEIEW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|