C28H29NO2 — CID 10001663
6-(2-methoxyphenyl)-2,2-dimethyl-4-[phenyl(prop-2-enoxy)methyl]-1H-quinoline (PubChem CID 10001663) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2,2-dimethyl-4-[phenyl(prop-2-enoxy)methyl]-1H-quinoline.
| Compound Name | 6-(2-methoxyphenyl)-2,2-dimethyl-4-[phenyl(prop-2-enoxy)methyl]-1H-quinoline |
|---|---|
| PubChem CID | 10001663 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 6-(2-methoxyphenyl)-2,2-dimethyl-4-[phenyl(prop-2-enoxy)methyl]-1H-quinoline |
| SMILES | C=CCOC(C1=CC(C)(C)Nc2ccc(-c3ccccc3OC)cc21)c1ccccc1 |
| InChI | InChI=1S/C28H29NO2/c1-5-17-31-27(20-11-7-6-8-12-20)24-19-28(2,3)29-25-16-15-21(18-23(24)25)22-13-9-10-14-26(22)30-4/h5-16,18-19,27,29H,1,17H2,2-4H3 |
| InChIKey | IGNUMFRXLRBTMF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|