C25H24ClNOS — CID 87724451
(4-chlorophenyl)-[6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinolin-4-yl]methanethiol (PubChem CID 87724451) has the molecular formula C25H24ClNOS and a molecular weight of 421.99 g/mol. Its IUPAC name is (4-chlorophenyl)-[6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinolin-4-yl]methanethiol.
| Compound Name | (4-chlorophenyl)-[6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinolin-4-yl]methanethiol |
|---|---|
| PubChem CID | 87724451 |
| Molecular Formula | C25H24ClNOS |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (4-chlorophenyl)-[6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinolin-4-yl]methanethiol |
| SMILES | COc1ccccc1-c1ccc2c(c1)C(C(S)c1ccc(Cl)cc1)=CC(C)(C)N2 |
| InChI | InChI=1S/C25H24ClNOS/c1-25(2)15-21(24(29)16-8-11-18(26)12-9-16)20-14-17(10-13-22(20)27-25)19-6-4-5-7-23(19)28-3/h4-15,24,27,29H,1-3H3 |
| InChIKey | ACJATDTUBGXSPM-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|