C24H29NO2 — CID 69153338
4-(1-but-2-enoxyethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (PubChem CID 69153338) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-(1-but-2-enoxyethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
| Compound Name | 4-(1-but-2-enoxyethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
|---|---|
| PubChem CID | 69153338 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-(1-but-2-enoxyethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| SMILES | CC=CCOC(C)C1=CC(C)(C)Nc2ccc(-c3ccccc3OC)cc21 |
| InChI | InChI=1S/C24H29NO2/c1-6-7-14-27-17(2)21-16-24(3,4)25-22-13-12-18(15-20(21)22)19-10-8-9-11-23(19)26-5/h6-13,15-17,25H,14H2,1-5H3 |
| InChIKey | JFEUWHWUEKXKKU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|