C25H29NO4 — CID 22566544
4-[1-[(E)-but-2-enoxy]ethyl]-6-(2-methoxyphenyl)-2,2-dimethylquinoline-1-carboxylic acid (PubChem CID 22566544) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[1-[(E)-but-2-enoxy]ethyl]-6-(2-methoxyphenyl)-2,2-dimethylquinoline-1-carboxylic acid.
| Compound Name | 4-[1-[(E)-but-2-enoxy]ethyl]-6-(2-methoxyphenyl)-2,2-dimethylquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 22566544 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-[1-[(E)-but-2-enoxy]ethyl]-6-(2-methoxyphenyl)-2,2-dimethylquinoline-1-carboxylic acid |
| SMILES | C/C=C/COC(C)C1=CC(C)(C)N(C(=O)O)c2ccc(-c3ccccc3OC)cc21 |
| InChI | InChI=1S/C25H29NO4/c1-6-7-14-30-17(2)21-16-25(3,4)26(24(27)28)22-13-12-18(15-20(21)22)19-10-8-9-11-23(19)29-5/h6-13,15-17H,14H2,1-5H3,(H,27,28)/b7-6+ |
| InChIKey | PUVHSLOYIYIXSY-VOTSOKGWSA-N |
| XLogP | 6.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|