C36H41F3N2O5S2 — CID 86592902
6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate (PubChem CID 86592902) has the molecular formula C36H41F3N2O5S2 and a molecular weight of 702.86 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate.
| Compound Name | 6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86592902 |
| Molecular Formula | C36H41F3N2O5S2 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-2,2-dimethyl-4-(prop-2-enylsulfanylmethyl)-1H-quinoline;(2,2,4-trimethyl-1H-quinolin-6-yl) trifluoromethanesulfonate |
| SMILES | C=CCSCC1=CC(C)(C)Nc2ccc(-c3cc(OC)ccc3OC)cc21.CC1=CC(C)(C)Nc2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C23H27NO2S.C13H14F3NO3S/c1-6-11-27-15-17-14-23(2,3)24-21-9-7-16(12-19(17)21)20-13-18(25-4)8-10-22(20)26-5;1-8-7-12(2,3)17-11-5-4-9(6-10(8)11)20-21(18,19)13(14,15)16/h6-10,12-14,24H,1,11,15H2,2-5H3;4-7,17H,1-3H3 |
| InChIKey | FARDOBYXCVRBQB-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|